|
CAS#: 2963-86-2 Product: 1,2-Dihydroacenaphthylene-1alpha,2alpha-Diol No suppilers available for the product. |
| Name | 1,2-Dihydroacenaphthylene-1alpha,2alpha-Diol |
|---|---|
| Synonyms | (1,2)-Acenaphthenediol; 1,2-Acenaphthylenediol, 1,2-Dihydro-; Nsc 243678 |
| Molecular Structure | ![]() |
| Molecular Formula | C12H10O2 |
| Molecular Weight | 186.21 |
| CAS Registry Number | 2963-86-2 |
| SMILES | C3=C1C2=C(C(O)C1O)C=CC=C2C=C3 |
| InChI | 1S/C12H10O2/c13-11-8-5-1-3-7-4-2-6-9(10(7)8)12(11)14/h1-6,11-14H |
| InChIKey | ARGFAPRYULRPAN-UHFFFAOYSA-N |
| Density | 1.445g/cm3 (Cal.) |
|---|---|
| Boiling point | 407.693°C at 760 mmHg (Cal.) |
| Flash point | 207.906°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1,2-Dihydroacenaphthylene-1alpha,2alpha-Diol |