|
CAS#: 29668-40-4 Product: Bicyclo[5.4.1]Dodeca-1(11),7,9-Triene No suppilers available for the product. |
| Name | Bicyclo[5.4.1]Dodeca-1(11),7,9-Triene |
|---|---|
| Synonyms | DICYCLO(5,4,1)-DODECA-1,3,5-TRIENE |
| Molecular Structure | ![]() |
| Molecular Formula | C12H16 |
| Molecular Weight | 160.26 |
| CAS Registry Number | 29668-40-4 |
| SMILES | C\21=C\C=C/C=C(/CCCCC1)C/2 |
| InChI | 1S/C12H16/c1-2-6-11-8-4-5-9-12(10-11)7-3-1/h4-5,8-9H,1-3,6-7,10H2 |
| InChIKey | ADMYOTYCXUQARO-UHFFFAOYSA-N |
| Density | 0.948g/cm3 (Cal.) |
|---|---|
| Boiling point | 278.233°C at 760 mmHg (Cal.) |
| Flash point | 99.105°C (Cal.) |
| Refractive index | 1.537 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Bicyclo[5.4.1]Dodeca-1(11),7,9-Triene |