|
CAS#: 29789-67-1 Product: (2E,6E)-3,7,11-Trimethyl-2,6,10-Dodecatrienenitrile No suppilers available for the product. |
| Name | (2E,6E)-3,7,11-Trimethyl-2,6,10-Dodecatrienenitrile |
|---|---|
| Synonyms | 3,7,11-TRIMETHYL-2,6,10-DODECATRIENENITRILE |
| Molecular Structure | ![]() |
| Molecular Formula | C15H23N |
| Molecular Weight | 217.35 |
| CAS Registry Number | 29789-67-1 |
| SMILES | CC(=CCC/C(=C/CC/C(=C/C#N)/C)/C)C |
| InChI | 1S/C15H23N/c1-13(2)7-5-8-14(3)9-6-10-15(4)11-12-16/h7,9,11H,5-6,8,10H2,1-4H3/b14-9+,15-11+ |
| InChIKey | KNFDAUYLUSORSX-YFVJMOTDSA-N |
| Density | 0.87g/cm3 (Cal.) |
|---|---|
| Boiling point | 335.509°C at 760 mmHg (Cal.) |
| Flash point | 157.415°C (Cal.) |
| Refractive index | 1.482 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for (2E,6E)-3,7,11-Trimethyl-2,6,10-Dodecatrienenitrile |