|
CAS#: 2979-54-6 Product: Phenyl Hippurate No suppilers available for the product. |
| Name | Phenyl Hippurate |
|---|---|
| Synonyms | 2-[(Oxo-Phenylmethyl)Amino]Acetic Acid Phenyl Ester; 2-(Benzoylamino)Acetic Acid Phenyl Ester; Phenyl 2-(Phenylcarbonylamino)Ethanoate |
| Molecular Structure | ![]() |
| Molecular Formula | C15H13NO3 |
| Molecular Weight | 255.27 |
| CAS Registry Number | 2979-54-6 |
| SMILES | C1=C(C=CC=C1)C(=O)NCC(=O)OC2=CC=CC=C2 |
| InChI | 1S/C15H13NO3/c17-14(19-13-9-5-2-6-10-13)11-16-15(18)12-7-3-1-4-8-12/h1-10H,11H2,(H,16,18) |
| InChIKey | ZOSCMQBDSZBUAI-UHFFFAOYSA-N |
| Density | 1.205g/cm3 (Cal.) |
|---|---|
| Boiling point | 482.177°C at 760 mmHg (Cal.) |
| Flash point | 245.412°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Phenyl Hippurate |