|
CAS#: 29873-99-2 Product: (1R,2R)-2-Isopropenyl-4-Isopropylidene-1-Methyl-1-Vinylcyclohexane No suppilers available for the product. |
| Name | (1R,2R)-2-Isopropenyl-4-Isopropylidene-1-Methyl-1-Vinylcyclohexane |
|---|---|
| Synonyms | γ-Elemene |
| Molecular Structure | ![]() |
| Molecular Formula | C15H24 |
| Molecular Weight | 204.35 |
| CAS Registry Number | 29873-99-2 |
| SMILES | C[C@]1(C=C)CC/C(C[C@@H]1C(C)=C)=C(/C)C |
| InChI | 1S/C15H24/c1-7-15(6)9-8-13(11(2)3)10-14(15)12(4)5/h7,14H,1,4,8-10H2,2-3,5-6H3/t14-,15+/m1/s1 |
| InChIKey | BQSLMQNYHVFRDT-CABCVRRESA-N |
| Density | 0.876g/cm3 (Cal.) |
|---|---|
| Boiling point | 258.16°C at 760 mmHg (Cal.) |
| Flash point | 101.298°C (Cal.) |
| Refractive index | 1.511 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for (1R,2R)-2-Isopropenyl-4-Isopropylidene-1-Methyl-1-Vinylcyclohexane |