Online Database of Chemicals from Around the World
| Name | 4,6-Dimethoxy-5-Nitro-2-Phenylpyrimidine |
|---|---|
| Synonyms | 4,6-Dimethoxy-5-Nitro-2-Phenyl-Pyrimidine; Pyrimidine, 4,6-Dimethoxy-5-Nitro-2-Phenyl- |
| Molecular Structure |  |
| Molecular Formula | C12H11N3O4 |
| Molecular Weight | 261.24 |
| CAS Registry Number | 29939-35-3 |
| EINECS | 249-965-1 |
| SMILES | C1=CC=CC=C1C2=NC(=C(C(=N2)OC)[N+]([O-])=O)OC |
| InChI | 1S/C12H11N3O4/c1-18-11-9(15(16)17)12(19-2)14-10(13-11)8-6-4-3-5-7-8/h3-7H,1-2H3 |
| InChIKey | FWIMKFKYOGWCNZ-UHFFFAOYSA-N |
| Density | 1.3g/cm3 (Cal.) |
|---|---|
| Boiling point | 336.233°C at 760 mmHg (Cal.) |
| Flash point | 157.148°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4,6-Dimethoxy-5-Nitro-2-Phenylpyrimidine |
