|
CAS#: 300360-28-5 Product: 1,2,5-Trimethyl-1H-Benzimidazole 3-Oxide No suppilers available for the product. |
| Name | 1,2,5-Trimethyl-1H-Benzimidazole 3-Oxide |
|---|---|
| Synonyms | 1,2,5-trimethyl-1H-benzo[d]imidazole 3-oxide; BAS 00112105 |
| Molecular Structure | ![]() |
| Molecular Formula | C10H12N2O |
| Molecular Weight | 176.22 |
| CAS Registry Number | 300360-28-5 |
| SMILES | [O-][n+]2c1cc(ccc1n(c2C)C)C |
| InChI | 1S/C10H12N2O/c1-7-4-5-9-10(6-7)12(13)8(2)11(9)3/h4-6H,1-3H3 |
| InChIKey | NOQIAGPPFKGAOW-UHFFFAOYSA-N |
| Density | 1.154g/cm3 (Cal.) |
|---|---|
| Boiling point | 341.767°C at 760 mmHg (Cal.) |
| Flash point | 160.495°C (Cal.) |
| Refractive index | 1.592 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1,2,5-Trimethyl-1H-Benzimidazole 3-Oxide |