|
CAS#: 300394-90-5 Product: 3,5-Diethoxy-2-Nitropyridine No suppilers available for the product. |
| Name | 3,5-Diethoxy-2-Nitropyridine |
|---|---|
| Synonyms | ZINC00331188 |
| Molecular Structure | ![]() |
| Molecular Formula | C9H12N2O4 |
| Molecular Weight | 212.20 |
| CAS Registry Number | 300394-90-5 |
| SMILES | O=[N+]([O-])c1ncc(OCC)cc1OCC |
| InChI | 1S/C9H12N2O4/c1-3-14-7-5-8(15-4-2)9(10-6-7)11(12)13/h5-6H,3-4H2,1-2H3 |
| InChIKey | DTZZORVJMAGUDK-UHFFFAOYSA-N |
| Density | 1.209g/cm3 (Cal.) |
|---|---|
| Boiling point | 367.828°C at 760 mmHg (Cal.) |
| Flash point | 176.256°C (Cal.) |
| Refractive index | 1.522 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3,5-Diethoxy-2-Nitropyridine |