|
CAS#: 300543-25-3 Product: 3-Ethoxy-5-Phenyl-4,5-Dihydro-1,2-Oxazol-5-Ol No suppilers available for the product. |
| Name | 3-Ethoxy-5-Phenyl-4,5-Dihydro-1,2-Oxazol-5-Ol |
|---|---|
| Synonyms | 3-ethoxy-5-phenyl-4,5-dihydroisoxazol-5-ol |
| Molecular Structure | ![]() |
| Molecular Formula | C11H13NO3 |
| Molecular Weight | 207.23 |
| CAS Registry Number | 300543-25-3 |
| SMILES | O(\C2=N\OC(O)(c1ccccc1)C2)CC |
| InChI | 1S/C11H13NO3/c1-2-14-10-8-11(13,15-12-10)9-6-4-3-5-7-9/h3-7,13H,2,8H2,1H3 |
| InChIKey | KXINREKGVYPKMV-UHFFFAOYSA-N |
| Density | 1.204g/cm3 (Cal.) |
|---|---|
| Boiling point | 323.862°C at 760 mmHg (Cal.) |
| Flash point | 149.667°C (Cal.) |
| Refractive index | 1.554 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3-Ethoxy-5-Phenyl-4,5-Dihydro-1,2-Oxazol-5-Ol |