Online Database of Chemicals from Around the World
|
CAS#: 300567-64-0 Product: 2,2,2-Trichloro-1-[5-(Diethylamino)-2-Furyl]Ethanol No suppilers available for the product. |
| Name | 2,2,2-Trichloro-1-[5-(Diethylamino)-2-Furyl]Ethanol |
|---|---|
| Synonyms | 2,2,2-trichloro-1-(5-(diethylamino)furan-2-yl)ethanol; 2,2,2-trichloro-1-[5-(diethylamino)-2-furyl]ethanol |
| Molecular Structure | ![CAS#: 300567-64-0, 2,2,2-Trichloro-1-[5-(Diethylamino)-2-Furyl]Ethanol](/moreStructures/300567-64-0.gif) |
| Molecular Formula | C10H14Cl3NO2 |
| Molecular Weight | 286.58 |
| CAS Registry Number | 300567-64-0 |
| SMILES | CCN(CC)c1ccc(o1)C(C(Cl)(Cl)Cl)O |
| InChI | 1S/C10H14Cl3NO2/c1-3-14(4-2)8-6-5-7(16-8)9(15)10(11,12)13/h5-6,9,15H,3-4H2,1-2H3 |
| InChIKey | YBHSTHTYEZBEEF-UHFFFAOYSA-N |
| Density | 1.374g/cm3 (Cal.) |
|---|---|
| Boiling point | 343.327°C at 760 mmHg (Cal.) |
| Flash point | 161.438°C (Cal.) |
| Refractive index | 1.563 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2,2,2-Trichloro-1-[5-(Diethylamino)-2-Furyl]Ethanol |