|
CAS#: 30131-50-1 Product: Diethyl 1,2,6-Trimethyl-4-(2-Nitrophenyl)-4H-Pyridine-3,5-Dicarboxylate No suppilers available for the product. |
| Name | Diethyl 1,2,6-Trimethyl-4-(2-Nitrophenyl)-4H-Pyridine-3,5-Dicarboxylate |
|---|---|
| Synonyms | 1,2,6-Trimethyl-4-(2-Nitrophenyl)-4H-Pyridine-3,5-Dicarboxylic Acid Diethyl Ester; 3,5-Pyridinedicarboxylic Acid, 1,4-Dihydro-4-(2-Nitrophenyl)-1,2,6-Trimethyl-, Diethyl Ester; Brn 0500252 |
| Molecular Structure | ![]() |
| Molecular Formula | C20H24N2O6 |
| Molecular Weight | 388.42 |
| CAS Registry Number | 30131-50-1 |
| SMILES | C2=C(C1C(=C(N(C(=C1C(OCC)=O)C)C)C)C(OCC)=O)C(=CC=C2)[N+]([O-])=O |
| InChI | 1S/C20H24N2O6/c1-6-27-19(23)16-12(3)21(5)13(4)17(20(24)28-7-2)18(16)14-10-8-9-11-15(14)22(25)26/h8-11,18H,6-7H2,1-5H3 |
| InChIKey | MICMKHYRWUPXSR-UHFFFAOYSA-N |
| Density | 1.213g/cm3 (Cal.) |
|---|---|
| Boiling point | 492.558°C at 760 mmHg (Cal.) |
| Flash point | 251.69°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Diethyl 1,2,6-Trimethyl-4-(2-Nitrophenyl)-4H-Pyridine-3,5-Dicarboxylate |