|
CAS#: 3015-20-1 Product: 1-(2-Prop-1-En-2-Yl-1-Benzofuran-5-Yl)Ethanone No suppilers available for the product. |
| Name | 1-(2-Prop-1-En-2-Yl-1-Benzofuran-5-Yl)Ethanone |
|---|---|
| Synonyms | 1-(2-Isopropenylbenzofuran-5-Yl)Ethanone; 1-(2-Isopropenyl-5-Benzofuranyl)Ethanone; Dehydrotremetone |
| Molecular Structure | ![]() |
| Molecular Formula | C13H12O2 |
| Molecular Weight | 200.24 |
| CAS Registry Number | 3015-20-1 |
| SMILES | C1=C(OC2=C1C=C(C(=O)C)C=C2)C(=C)C |
| InChI | 1S/C13H12O2/c1-8(2)13-7-11-6-10(9(3)14)4-5-12(11)15-13/h4-7H,1H2,2-3H3 |
| InChIKey | DMYZBECNVZSNRN-UHFFFAOYSA-N |
| Density | 1.09g/cm3 (Cal.) |
|---|---|
| Boiling point | 311.589°C at 760 mmHg (Cal.) |
| Flash point | 143.248°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-(2-Prop-1-En-2-Yl-1-Benzofuran-5-Yl)Ethanone |