|
CAS#: 30165-93-6 Product: Ethyl 5-Chloro-1-(4-Chlorophenyl)-1H-1,2,3-Triazole-4-Carboxylate No suppilers available for the product. |
| Name | Ethyl 5-Chloro-1-(4-Chlorophenyl)-1H-1,2,3-Triazole-4-Carboxylate |
|---|---|
| Synonyms | ethyl 5-c |
| Molecular Structure | ![]() |
| Molecular Formula | C11H9Cl2N3O2 |
| Molecular Weight | 286.11 |
| CAS Registry Number | 30165-93-6 |
| SMILES | Clc1n(nnc1C(=O)OCC)c2ccc(Cl)cc2 |
| InChI | 1S/C11H9Cl2N3O2/c1-2-18-11(17)9-10(13)16(15-14-9)8-5-3-7(12)4-6-8/h3-6H,2H2,1H3 |
| InChIKey | KKPWEXBXZHTZFB-UHFFFAOYSA-N |
| Density | 1.471g/cm3 (Cal.) |
|---|---|
| Boiling point | 420.45°C at 760 mmHg (Cal.) |
| Flash point | 208.081°C (Cal.) |
| Refractive index | 1.633 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Ethyl 5-Chloro-1-(4-Chlorophenyl)-1H-1,2,3-Triazole-4-Carboxylate |