|
CAS#: 30203-84-0 Product: 1-Bromo-4-[(4-Chlorophenyl)Methyl]Benzene No suppilers available for the product. |
| Name | 1-Bromo-4-[(4-Chlorophenyl)Methyl]Benzene |
|---|---|
| Synonyms | 1-Bromo-4-(4-Chlorobenzyl)Benzene; Nsc97073; Methane, (P-Bromophenyl)-(P-Chlorophenyl)- |
| Molecular Structure | ![]() |
| Molecular Formula | C13H10BrCl |
| Molecular Weight | 281.58 |
| CAS Registry Number | 30203-84-0 |
| SMILES | C1=C(C=CC(=C1)CC2=CC=C(C=C2)Br)Cl |
| InChI | 1S/C13H10BrCl/c14-12-5-1-10(2-6-12)9-11-3-7-13(15)8-4-11/h1-8H,9H2 |
| InChIKey | OBOCHBYNINNMQI-UHFFFAOYSA-N |
| Density | 1.43g/cm3 (Cal.) |
|---|---|
| Boiling point | 344.787°C at 760 mmHg (Cal.) |
| Flash point | 189.01°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-Bromo-4-[(4-Chlorophenyl)Methyl]Benzene |