|
CAS#: 30229-42-6 Product: Vinyl acetate, butyl acrylate, methyl methacrylate polymer No suppilers available for the product. |
| Name | Vinyl acetate, butyl acrylate, methyl methacrylate polymer |
|---|---|
| Synonyms | Butyl Prop-2-Enoate; Methyl 2-Methylprop-2-Enoate; Vinyl Acetate; Acetic Acid Vinyl Ester; 2-Methylprop-2-Enoic Acid Methyl Ester; Prop-2-Enoic Acid Butyl Ester |
| Molecular Structure | ![]() |
| Molecular Formula | C16H26O6 |
| Molecular Weight | 314.38 |
| CAS Registry Number | 30229-42-6 |
| SMILES | CC(C(OC)=O)=C.C(OC(=O)C=C)CCC.CC(OC=C)=O |
| InChI | 1S/C7H12O2.C5H8O2.C4H6O2/c1-3-5-6-9-7(8)4-2;1-4(2)5(6)7-3;1-3-6-4(2)5/h4H,2-3,5-6H2,1H3;1H2,2-3H3;3H,1H2,2H3 |
| InChIKey | OBDRUIIBHOMNPP-UHFFFAOYSA-N |
| Boiling point | 145.9°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 39.4°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Vinyl acetate, butyl acrylate, methyl methacrylate polymer |