|
CAS#: 30231-49-3 Product: 2-Methyl-2-propenoic acid, butyl 2-propenoate, butyl 2-methyl-2-propenoate polymer No suppilers available for the product. |
| Name | 2-Methyl-2-propenoic acid, butyl 2-propenoate, butyl 2-methyl-2-propenoate polymer |
|---|---|
| Synonyms | 2-Methylprop-2-Enoic Acid; 2-Methylprop-2-Enoic Acid Butyl Ester; Prop-2-Enoic Acid Butyl Ester; Acrylic Acid Butyl Ester; Methacrylic Acid; 2-Methylacrylic Acid Butyl Ester |
| Molecular Structure | ![]() |
| Molecular Formula | C19H32O6 |
| Molecular Weight | 356.46 |
| CAS Registry Number | 30231-49-3 |
| SMILES | C(OC(=O)C(=C)C)CCC.C(OC(=O)C=C)CCC.CC(C(=O)O)=C |
| InChI | 1S/C8H14O2.C7H12O2.C4H6O2/c1-4-5-6-10-8(9)7(2)3;1-3-5-6-9-7(8)4-2;1-3(2)4(5)6/h2,4-6H2,1,3H3;4H,2-3,5-6H2,1H3;1H2,2H3,(H,5,6) |
| InChIKey | PEFPZMNBBUUOIG-UHFFFAOYSA-N |
| Boiling point | 160°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 50.6°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-Methyl-2-propenoic acid, butyl 2-propenoate, butyl 2-methyl-2-propenoate polymer |