|
CAS#: 30368-31-1 Product: Methyl 8-Phenylnonanoate No suppilers available for the product. |
| Name | Methyl 8-Phenylnonanoate |
|---|---|
| Molecular Structure | ![]() |
| Molecular Formula | C16H24O2 |
| Molecular Weight | 248.36 |
| CAS Registry Number | 30368-31-1 |
| SMILES | O=C(OC)CCCCCCC(c1ccccc1)C |
| InChI | 1S/C16H24O2/c1-14(15-11-7-5-8-12-15)10-6-3-4-9-13-16(17)18-2/h5,7-8,11-12,14H,3-4,6,9-10,13H2,1-2H3 |
| InChIKey | ADOCTUYWNUQUDG-UHFFFAOYSA-N |
| Density | 0.961g/cm3 (Cal.) |
|---|---|
| Boiling point | 328.718°C at 760 mmHg (Cal.) |
| Flash point | 109.103°C (Cal.) |
| Refractive index | 1.489 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Methyl 8-Phenylnonanoate |