|
CAS#: 3038-60-6 Product: 2-[[4-(Trifluoromethyl)Phenyl]Methyl]-4,5-Dihydro-1H-Imidazole No suppilers available for the product. |
| Name | 2-[[4-(Trifluoromethyl)Phenyl]Methyl]-4,5-Dihydro-1H-Imidazole |
|---|---|
| Synonyms | 2-[4-(Trifluoromethyl)Benzyl]-4,5-Dihydro-1H-Imidazole; Brn 0915364; 2-(P-Trifluoromethylbenzyl)-2-Imidazoline |
| Molecular Structure | ![]() |
| Molecular Formula | C11H11F3N2 |
| Molecular Weight | 228.22 |
| CAS Registry Number | 3038-60-6 |
| SMILES | C1=C(C(F)(F)F)C=CC(=C1)CC2=NCCN2 |
| InChI | 1S/C11H11F3N2/c12-11(13,14)9-3-1-8(2-4-9)7-10-15-5-6-16-10/h1-4H,5-7H2,(H,15,16) |
| InChIKey | OXIKUCONSRWLPM-UHFFFAOYSA-N |
| Density | 1.295g/cm3 (Cal.) |
|---|---|
| Boiling point | 338.322°C at 760 mmHg (Cal.) |
| Flash point | 158.412°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-[[4-(Trifluoromethyl)Phenyl]Methyl]-4,5-Dihydro-1H-Imidazole |