|
CAS#: 30451-32-2 Product: 4,7-Dihydro-2-Phenyl-4,7-Methanoisoindole No suppilers available for the product. |
| Name | 4,7-Dihydro-2-Phenyl-4,7-Methanoisoindole |
|---|---|
| Synonyms | 4,7-Methanoisoindole, 4,7-Dihydro-2-Phenyl-; Brn 1246665 |
| Molecular Structure | ![]() |
| Molecular Formula | C15H13N |
| Molecular Weight | 207.27 |
| CAS Registry Number | 30451-32-2 |
| SMILES | C1=C3C(=C[N]1C2=CC=CC=C2)C4C=CC3C4 |
| InChI | 1S/C15H13N/c1-2-4-13(5-3-1)16-9-14-11-6-7-12(8-11)15(14)10-16/h1-7,9-12H,8H2 |
| InChIKey | WURBIZFBXGCLBU-UHFFFAOYSA-N |
| Density | 1.214g/cm3 (Cal.) |
|---|---|
| Boiling point | 340.159°C at 760 mmHg (Cal.) |
| Flash point | 159.523°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4,7-Dihydro-2-Phenyl-4,7-Methanoisoindole |