|
CAS#: 30489-67-9 Product: 1-Methylbenzo[f]Benzimidazol-2-Amine No suppilers available for the product. |
| Name | 1-Methylbenzo[f]Benzimidazol-2-Amine |
|---|---|
| Synonyms | 1-Methyl-2-Benzo[F]Benzimidazolamine; (1-Methylbenzo[F]Benzimidazol-2-Yl)Amine; 1-Methylnaphth(2,3-D)Imidazol-2-Amine |
| Molecular Structure | ![]() |
| Molecular Formula | C12H11N3 |
| Molecular Weight | 197.24 |
| CAS Registry Number | 30489-67-9 |
| SMILES | C2=C1[N](C(=NC1=CC3=CC=CC=C23)N)C |
| InChI | 1S/C12H11N3/c1-15-11-7-9-5-3-2-4-8(9)6-10(11)14-12(15)13/h2-7H,1H3,(H2,13,14) |
| InChIKey | VMUVKMYWLOSNOS-UHFFFAOYSA-N |
| Density | 1.301g/cm3 (Cal.) |
|---|---|
| Boiling point | 440.358°C at 760 mmHg (Cal.) |
| Flash point | 220.121°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-Methylbenzo[f]Benzimidazol-2-Amine |