Online Database of Chemicals from Around the World
|
CAS#: 30509-58-1 Product: 5-Amino-2-Prop-2-Enoxy-N-Prop-2-Enylbenzamide No suppilers available for the product. |
| Name | 5-Amino-2-Prop-2-Enoxy-N-Prop-2-Enylbenzamide |
|---|---|
| Synonyms | N-Allyl-2-Allyloxy-5-Amino-Benzamide; N-Allyl-2-Allyloxy-5-Aminobenzamide; 5-Amino-2-Prop-2-Enoxy-N-Prop-2-Enyl-Benzamide |
| Molecular Structure |  |
| Molecular Formula | C13H16N2O2 |
| Molecular Weight | 232.28 |
| CAS Registry Number | 30509-58-1 |
| SMILES | C1=C(C(=CC(=C1)N)C(=O)NCC=C)OCC=C |
| InChI | 1S/C13H16N2O2/c1-3-7-15-13(16)11-9-10(14)5-6-12(11)17-8-4-2/h3-6,9H,1-2,7-8,14H2,(H,15,16) |
| InChIKey | HHIFWYWJNCLVIN-UHFFFAOYSA-N |
| Density | 1.094g/cm3 (Cal.) |
|---|---|
| Boiling point | 403.692°C at 760 mmHg (Cal.) |
| Flash point | 197.946°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 5-Amino-2-Prop-2-Enoxy-N-Prop-2-Enylbenzamide |