|
CAS#: 30544-59-3 Product: 4-[Acetyl-(3-Chlorophenyl)Amino]Butanoic Acid No suppilers available for the product. |
| Name | 4-[Acetyl-(3-Chlorophenyl)Amino]Butanoic Acid |
|---|---|
| Synonyms | 4-[Acetyl-(3-Chlorophenyl)Amino]Butyric Acid; 4-[(3-Chlorophenyl)-Ethanoyl-Amino]Butanoic Acid; 4-(N-(M-Chlorophenyl)Acetamido)Butyric Acid |
| Molecular Structure | ![]() |
| Molecular Formula | C12H14ClNO3 |
| Molecular Weight | 255.70 |
| CAS Registry Number | 30544-59-3 |
| SMILES | C1=C(C=CC=C1N(CCCC(O)=O)C(C)=O)Cl |
| InChI | 1S/C12H14ClNO3/c1-9(15)14(7-3-6-12(16)17)11-5-2-4-10(13)8-11/h2,4-5,8H,3,6-7H2,1H3,(H,16,17) |
| InChIKey | WBPKBWRYABHDIG-UHFFFAOYSA-N |
| Density | 1.297g/cm3 (Cal.) |
|---|---|
| Boiling point | 445.284°C at 760 mmHg (Cal.) |
| Flash point | 223.1°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4-[Acetyl-(3-Chlorophenyl)Amino]Butanoic Acid |