|
CAS#: 30622-37-8 Product: Penta-s-triazinetrione No suppilers available for the product. |
| Name | Penta-s-triazinetrione |
|---|---|
| Synonyms | Potassium; 1,5-Dichloro-4,6-Diketo-S-Triazin-2-Olate; 1,3,5-Trichloro-1,3,5-Triazinane-2,4,6-Trione; 1,3,5-Triazine-2,4,6(1H,3H,5H)-Trione, 1,3,5-Trichloro-, Mixt. With 1,3-Dichloro-1,3,5-Triazine-2,4,6(1H,3H,5H)-Trione Potassium Salt; Penta-S-Triazinetrione |
| Molecular Structure | ![]() |
| Molecular Formula | C6Cl5KN6O6 |
| Molecular Weight | 468.47 |
| CAS Registry Number | 30622-37-8 |
| SMILES | [N-]1C(=O)N(Cl)C(=O)N(Cl)C1=O.O=C2N(Cl)C(=O)N(Cl)C(=O)N2Cl.[K+] |
| InChI | 1S/C3Cl3N3O3.C3HCl2N3O3.K/c4-7-1(10)8(5)3(12)9(6)2(7)11;4-7-1(9)6-2(10)8(5)3(7)11;/h;(H,6,9,10);/q;;+1/p-1 |
| InChIKey | PKUZBZHKZBYTJJ-UHFFFAOYSA-M |
| Boiling point | 272.3°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 118.5°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Penta-s-triazinetrione |