|
CAS#: 3067-14-9 Product: Benzo[b]Pyrene-3,6-Dione No suppilers available for the product. |
| Name | Benzo[b]Pyrene-3,6-Dione |
|---|---|
| Synonyms | Benzo[B]Pyrene-3,6-Quinone; Bp-3,6-Quinone; Brn 2334218 |
| Molecular Structure | ![]() |
| Molecular Formula | C20H10O2 |
| Molecular Weight | 282.30 |
| CAS Registry Number | 3067-14-9 |
| SMILES | C2=CC5=C1C(=CC=C3C1=C2C(=O)C4=C3C=CC=C4)C=CC5=O |
| InChI | 1S/C20H10O2/c21-17-10-6-11-5-7-13-12-3-1-2-4-14(12)20(22)16-9-8-15(17)18(11)19(13)16/h1-10H |
| InChIKey | MYRYNZSMCVOJHZ-UHFFFAOYSA-N |
| Density | 1.427g/cm3 (Cal.) |
|---|---|
| Boiling point | 563.924°C at 760 mmHg (Cal.) |
| Flash point | 206.169°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Benzo[b]Pyrene-3,6-Dione |