|
CAS#: 306936-13-0 Product: 5-(4-Chlorophenyl)-2-(1,3-Dioxolan-2-Yl)-3-Furoic Acid No suppilers available for the product. |
| Name | 5-(4-Chlorophenyl)-2-(1,3-Dioxolan-2-Yl)-3-Furoic Acid |
|---|---|
| Synonyms | 3-FURANCA |
| Molecular Structure | ![]() |
| Molecular Formula | C14H11ClO5 |
| Molecular Weight | 294.69 |
| CAS Registry Number | 306936-13-0 |
| SMILES | Clc3ccc(c1oc(c(c1)C(=O)O)C2OCCO2)cc3 |
| InChI | 1S/C14H11ClO5/c15-9-3-1-8(2-4-9)11-7-10(13(16)17)12(20-11)14-18-5-6-19-14/h1-4,7,14H,5-6H2,(H,16,17) |
| InChIKey | FYHSHOIWNAJTMZ-UHFFFAOYSA-N |
| Density | 1.42g/cm3 (Cal.) |
|---|---|
| Boiling point | 459.039°C at 760 mmHg (Cal.) |
| Flash point | 231.419°C (Cal.) |
| Refractive index | 1.592 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 5-(4-Chlorophenyl)-2-(1,3-Dioxolan-2-Yl)-3-Furoic Acid |