Online Database of Chemicals from Around the World
| Alfa Chemistry | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (201) 478-8534 | |||
 |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
|
+1 (631) 485-4226 | |||
|
info@bocsci.com | |||
 |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink massive supplier since 2012 | ||||
| Name | 6beta,8alpha-Dihydro-Cyclobut[a]Acenaphthylene |
|---|---|
| Synonyms | 6B,8A-Dihydrocyclobuta[A]Acenaphthylene; 6B,8A-Dihydrocyclobut(A)Acenaphthylene |
| Molecular Structure | ![CAS#: 30736-79-9, 6beta,8alpha-Dihydro-Cyclobut[a]Acenaphthylene](/moreStructures/30736-79-9.gif) |
| Molecular Formula | C14H10 |
| Molecular Weight | 178.23 |
| CAS Registry Number | 30736-79-9 |
| SMILES | C2=C1C=CC=C3C1=C(C=C2)C4C3C=C4 |
| InChI | 1S/C14H10/c1-3-9-4-2-6-13-11-8-7-10(11)12(5-1)14(9)13/h1-8,10-11H |
| InChIKey | MKRSLSRLZZVPKE-UHFFFAOYSA-N |
| Density | 1.232g/cm3 (Cal.) |
|---|---|
| Boiling point | 300.777°C at 760 mmHg (Cal.) |
| Flash point | 138.645°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 6beta,8alpha-Dihydro-Cyclobut[a]Acenaphthylene |