|
CAS#: 3079-03-6 Product: [4-(Dimethylsulfamoyl)Phenyl] Diethyl Phosphate No suppilers available for the product. |
| Name | [4-(Dimethylsulfamoyl)Phenyl] Diethyl Phosphate |
|---|---|
| Synonyms | Phosphoric Acid [4-(Dimethylsulfamoyl)Phenyl] Diethyl Ester; O,O-Diethyl O-(N,N-Dimethyl-P-Sulfamoylphenyl)Phosphate; Brn 2706693 |
| Molecular Structure | ![]() |
| Molecular Formula | C12H20NO6PS |
| Molecular Weight | 337.33 |
| CAS Registry Number | 3079-03-6 |
| SMILES | C1=CC(=CC=C1[S](N(C)C)(=O)=O)O[P](=O)(OCC)OCC |
| InChI | 1S/C12H20NO6PS/c1-5-17-20(14,18-6-2)19-11-7-9-12(10-8-11)21(15,16)13(3)4/h7-10H,5-6H2,1-4H3 |
| InChIKey | LWHKUUSAXOVOEU-UHFFFAOYSA-N |
| Density | 1.271g/cm3 (Cal.) |
|---|---|
| Boiling point | 404.15°C at 760 mmHg (Cal.) |
| Flash point | 198.223°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for [4-(Dimethylsulfamoyl)Phenyl] Diethyl Phosphate |