Online Database of Chemicals from Around the World
|
CAS#: 308-26-9 Product: 2,2,3,3,4,4,5,5,5-Nonafluoropentyl Prop-2-Enoate No suppilers available for the product. |
| Name | 2,2,3,3,4,4,5,5,5-Nonafluoropentyl Prop-2-Enoate |
|---|---|
| Synonyms | Prop-2-Enoic Acid 2,2,3,3,4,4,5,5,5-Nonafluoropentyl Ester; Acrylic Acid 2,2,3,3,4,4,5,5,5-Nonafluoropentyl Ester; 2,2,3,3,4,4,5,5,5-Nonafluoropentyl Acrylate |
| Molecular Structure |  |
| Molecular Formula | C8H5F9O2 |
| Molecular Weight | 304.11 |
| CAS Registry Number | 308-26-9 |
| EINECS | 206-214-2 |
| SMILES | C(C(C(C(C(F)(F)F)(F)F)(F)F)(F)F)OC(C=C)=O |
| InChI | 1S/C8H5F9O2/c1-2-4(18)19-3-5(9,10)6(11,12)7(13,14)8(15,16)17/h2H,1,3H2 |
| InChIKey | UOKXSSAMUUASQX-UHFFFAOYSA-N |
| Density | 1.459g/cm3 (Cal.) |
|---|---|
| Boiling point | 144.568°C at 760 mmHg (Cal.) |
| Flash point | 40.853°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2,2,3,3,4,4,5,5,5-Nonafluoropentyl Prop-2-Enoate |