| Alfa Chemistry | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (201) 478-8534 | |||
![]() |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (631) 485-4226 | |||
![]() |
info@bocsci.com | |||
![]() |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink massive supplier since 2012 | ||||
| Name | (2-Hydroxyethyl)Ammonium Octyl Sulphate |
|---|---|
| Synonyms | (2-Hydroxyethyl)Ammonium Octyl Sulphate; Sulfuric Acid, Monooctyl Ester, Compd. With 2-Aminoethanol (1:1) |
| Molecular Structure | ![]() |
| Molecular Formula | C10H25NO5S |
| Molecular Weight | 271.37 |
| CAS Registry Number | 30862-35-2 |
| EINECS | 250-365-7 |
| SMILES | C(O[S](=O)(=O)O)CCCCCCC.C(O)CN |
| InChI | 1S/C8H18O4S.C2H7NO/c1-2-3-4-5-6-7-8-12-13(9,10)11;3-1-2-4/h2-8H2,1H3,(H,9,10,11);4H,1-3H2 |
| InChIKey | IEHXRVXDZGSPOC-UHFFFAOYSA-N |
| Boiling point | 448.7°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 225.2°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for (2-Hydroxyethyl)Ammonium Octyl Sulphate |