|
CAS#: 30888-05-2 Product: 3,8-Dihydroxy-3-Methylisochroman-1-One No suppilers available for the product. |
| Name | 3,8-Dihydroxy-3-Methylisochroman-1-One |
|---|---|
| Synonyms | 3,8-Dihydroxy-3-Methyl-Isochroman-1-One; 3,8-Dihydroxy-3-Methyl-1-Isochromanone; Brn 3049810 |
| Molecular Structure | ![]() |
| Molecular Formula | C10H10O4 |
| Molecular Weight | 194.19 |
| CAS Registry Number | 30888-05-2 |
| SMILES | C1=C2C(=C(O)C=C1)C(OC(C2)(O)C)=O |
| InChI | 1S/C10H10O4/c1-10(13)5-6-3-2-4-7(11)8(6)9(12)14-10/h2-4,11,13H,5H2,1H3 |
| InChIKey | SDGOMJUKDHSPPU-UHFFFAOYSA-N |
| Density | 1.411g/cm3 (Cal.) |
|---|---|
| Boiling point | 454.842°C at 760 mmHg (Cal.) |
| Flash point | 189.119°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3,8-Dihydroxy-3-Methylisochroman-1-One |