|
CAS#: 30959-09-2 Product: 7',10,11-Trimethoxy-1',2'-Didehydroemetan-6'-Ol Ethanedioate (1:1) No suppilers available for the product. |
| Name | 7',10,11-Trimethoxy-1',2'-Didehydroemetan-6'-Ol Ethanedioate (1:1) |
|---|---|
| Synonyms | psychotrine dihydrogen oxalate |
| Molecular Structure | ![]() |
| Molecular Formula | C30H38N2O8 |
| Molecular Weight | 554.63 |
| CAS Registry Number | 30959-09-2 |
| SMILES | OC(=O)C(O)=O.Oc4cc5CC\N=C(\C[C@H]1C[C@H]2c3cc(OC)c(OC)cc3CCN2C[C@@H]1CC)c5cc4OC |
| InChI | 1S/C28H36N2O4.C2H2O4/c1-5-17-16-30-9-7-19-13-27(33-3)28(34-4)15-22(19)24(30)11-20(17)10-23-21-14-26(32-2)25(31)12-18(21)6-8-29-23;3-1(4)2(5)6/h12-15,17,20,24,31H,5-11,16H2,1-4H3;(H,3,4)(H,5,6)/t17-,20-,24-;/m0./s1 |
| InChIKey | LDPBSCQIEPAWML-TWAIVCOHSA-N |
| Boiling point | 751.3°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 408.2°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 7',10,11-Trimethoxy-1',2'-Didehydroemetan-6'-Ol Ethanedioate (1:1) |