|
CAS#: 3114-54-3 Product: 2,4,6-Tris(4-Chlorophenyl)-1,3,5-Triazine No suppilers available for the product. |
| Name | 2,4,6-Tris(4-Chlorophenyl)-1,3,5-Triazine |
|---|---|
| Synonyms | 2,4,6-Tris(4-Chlorophenyl)-S-Triazine; 1,3,5-Triazine, 2,4,6-Tris(4-Chlorophenyl)-; 2,4,6-Tris(P-Chlorophenyl)-S-Triazine |
| Molecular Structure | ![]() |
| Molecular Formula | C21H12Cl3N3 |
| Molecular Weight | 412.70 |
| CAS Registry Number | 3114-54-3 |
| SMILES | C1=CC(=CC=C1Cl)C2=NC(=NC(=N2)C3=CC=C(C=C3)Cl)C4=CC=C(C=C4)Cl |
| InChI | 1S/C21H12Cl3N3/c22-16-7-1-13(2-8-16)19-25-20(14-3-9-17(23)10-4-14)27-21(26-19)15-5-11-18(24)12-6-15/h1-12H |
| InChIKey | HNUCWEZQTAGOAW-UHFFFAOYSA-N |
| Density | 1.372g/cm3 (Cal.) |
|---|---|
| Boiling point | 597.051°C at 760 mmHg (Cal.) |
| Flash point | 342.368°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2,4,6-Tris(4-Chlorophenyl)-1,3,5-Triazine |