|
CAS#: 313-80-4 Product: Naphtho(2,1,8-Def)Quinoline No suppilers available for the product. |
| Name | Naphtho(2,1,8-Def)Quinoline |
|---|---|
| Synonyms | 1-Azapyrene; Brn 1309567; Ccris 1257 |
| Molecular Structure | ![]() |
| Molecular Formula | C15H9N |
| Molecular Weight | 203.24 |
| CAS Registry Number | 313-80-4 |
| SMILES | C1=NC4=C2C(=C1)C=CC3=CC=CC(=C23)C=C4 |
| InChI | 1S/C15H9N/c1-2-10-4-5-12-8-9-16-13-7-6-11(3-1)14(10)15(12)13/h1-9H |
| InChIKey | QHADMMAFBAZFTE-UHFFFAOYSA-N |
| Density | 1.31g/cm3 (Cal.) |
|---|---|
| Boiling point | 385.51°C at 760 mmHg (Cal.) |
| Flash point | 172.96°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Naphtho(2,1,8-Def)Quinoline |