|
CAS#: 31370-61-3 Product: 1,3-Diisocyanato-2-Methylbenzene - 2,4-Diisocyanato-1-Methylbenzene (1:1) No suppilers available for the product. |
| Name | 1,3-Diisocyanato-2-Methylbenzene - 2,4-Diisocyanato-1-Methylbenzene (1:1) |
|---|---|
| Synonyms | 2,4 + 2,6-Toluenediisocyanate; 2,4-/2,6-Toluene diisocyanate mixture |
| Molecular Structure | ![]() |
| Molecular Formula | C18H12N4O4 |
| Molecular Weight | 348.31 |
| CAS Registry Number | 31370-61-3 |
| SMILES | O=C=N\c1ccc(c(\N=C=O)c1)C.O=C=N/c1cccc(\N=C=O)c1C |
| InChI | 1S/2C9H6N2O2/c1-7-2-3-8(10-5-12)4-9(7)11-6-13;1-7-8(10-5-12)3-2-4-9(7)11-6-13/h2*2-4H,1H3 |
| InChIKey | LNKSOGFDOODVSP-UHFFFAOYSA-N |
| Boiling point | 248.4°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 110.5°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1,3-Diisocyanato-2-Methylbenzene - 2,4-Diisocyanato-1-Methylbenzene (1:1) |