Online Database of Chemicals from Around the World
|
CAS#: 3145-11-7 Product: 1,1'-(2,4,6-Trihydroxy-1,3-Phenylene)Di(1-Propanone) No suppilers available for the product. |
| Name | 1,1'-(2,4,6-Trihydroxy-1,3-Phenylene)Di(1-Propanone) |
|---|---|
| Synonyms | 1-(2,4,6-Trihydroxy-3-propionyl-phenyl)-propan-1-one; 1,1'-(2,4,6-trihydroxybenzene-1,3-diyl)dipropan-1-one; 1-propanone, 1,1'-(2,4,6-trihydroxy-1,3-phenylene)bis- |
| Molecular Structure |  |
| Molecular Formula | C12H14O5 |
| Molecular Weight | 238.24 |
| CAS Registry Number | 3145-11-7 |
| SMILES | CCC(=O)C1=C(C(=C(C=C1O)O)C(=O)CC)O |
| InChI | 1S/C12H14O5/c1-3-6(13)10-8(15)5-9(16)11(12(10)17)7(14)4-2/h5,15-17H,3-4H2,1-2H3 |
| InChIKey | MAULNQUCMOQLDU-UHFFFAOYSA-N |
| Density | 1.3±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 394.8±42.0°C at 760 mmHg (Cal.) |
| Flash point | 206.7±24.4°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1,1'-(2,4,6-Trihydroxy-1,3-Phenylene)Di(1-Propanone) |