|
CAS#: 31550-14-8 Product: 2-Methyl-2-Propenoic acid polymer with ethenyl acetate and ethyl2-propenoate No suppilers available for the product. |
| Name | 2-Methyl-2-Propenoic acid polymer with ethenyl acetate and ethyl2-propenoate |
|---|---|
| Synonyms | 2-Methylenebutanoic Acid; 2-Methylprop-2-Enoic Acid; Vinyl Acetate; Acetic Acid Vinyl Ester; 2-Methylenebutanoic Acid; 2-Methylprop-2-Enoic Acid |
| Molecular Structure | ![]() |
| Molecular Formula | C13H20O6 |
| Molecular Weight | 272.30 |
| CAS Registry Number | 31550-14-8 |
| SMILES | C(C(C(=O)O)=C)C.CC(OC=C)=O.CC(C(=O)O)=C |
| InChI | 1S/C5H8O2.2C4H6O2/c1-3-4(2)5(6)7;1-3-6-4(2)5;1-3(2)4(5)6/h2-3H2,1H3,(H,6,7);3H,1H2,2H3;1H2,2H3,(H,5,6) |
| InChIKey | PHYCQAPGOLYKFI-UHFFFAOYSA-N |
| Boiling point | 186.3°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 91.6°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-Methyl-2-Propenoic acid polymer with ethenyl acetate and ethyl2-propenoate |