Online Database of Chemicals from Around the World
| Alfa Chemistry | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (201) 478-8534 | |||
 |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| Name | 1,5-Diamino-2,3-Dibromo-4,8-Dihydroxyanthracene-9,10-Dione |
|---|---|
| Synonyms | 1,5-Diamino-2,3-Dibromo-4,8-Dihydroxy-Anthracene-9,10-Dione; 1,5-Diamino-2,3-Dibromo-4,8-Dihydroxy-9,10-Anthraquinone; Dibromo-1,5-Diamino-4,8-Dihydroxyanthraquinone |
| Molecular Structure |  |
| Molecular Formula | C14H8Br2N2O4 |
| Molecular Weight | 428.04 |
| CAS Registry Number | 31626-19-4 |
| EINECS | 250-735-8 |
| SMILES | C3=C(O)C2=C(C(=O)C1=C(O)C(=C(Br)C(=C1C2=O)N)Br)C(=C3)N |
| InChI | 1S/C14H8Br2N2O4/c15-9-10(16)14(22)8-7(11(9)18)13(21)6-4(19)2-1-3(17)5(6)12(8)20/h1-2,19,22H,17-18H2 |
| InChIKey | SPVORLXNUCZWOC-UHFFFAOYSA-N |
| Density | 2.219g/cm3 (Cal.) |
|---|---|
| Boiling point | 692.212°C at 760 mmHg (Cal.) |
| Flash point | 372.437°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1,5-Diamino-2,3-Dibromo-4,8-Dihydroxyanthracene-9,10-Dione |