|
CAS#: 31652-37-6 Product: 7-Methoxy-4,9-Dihydro-3H-Pyrido[3,4-b]Indole No suppilers available for the product. |
| Name | 7-Methoxy-4,9-Dihydro-3H-Pyrido[3,4-b]Indole |
|---|---|
| Synonyms | 7-Methoxy-4,9-Dihydro-3H-$B-Carboline; Cgs-19281A; 3H-Pyrido(3,4-B)Indole, 4,9-Dihydro-7-Methoxy- |
| Molecular Structure | ![]() |
| Molecular Formula | C12H12N2O |
| Molecular Weight | 200.24 |
| CAS Registry Number | 31652-37-6 |
| SMILES | C3=CC1=C([NH]C2=C1CCN=C2)C=C3OC |
| InChI | 1S/C12H12N2O/c1-15-8-2-3-9-10-4-5-13-7-12(10)14-11(9)6-8/h2-3,6-7,14H,4-5H2,1H3 |
| InChIKey | VTEZDUSEJVSZGQ-UHFFFAOYSA-N |
| Density | 1.29g/cm3 (Cal.) |
|---|---|
| Boiling point | 413.139°C at 760 mmHg (Cal.) |
| Flash point | 203.659°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 7-Methoxy-4,9-Dihydro-3H-Pyrido[3,4-b]Indole |