|
CAS#: 31702-33-7 Product: 1,1,3-Trichloro-2-Methylprop-1-Ene No suppilers available for the product. |
| Name | 1,1,3-Trichloro-2-Methylprop-1-Ene |
|---|---|
| Synonyms | 1,1,3-Trichloro-2-Methyl-Prop-1-Ene; Propene, 1,1,3-Trichloro-2-Methyl-; Inchi=1/C4h5cl3/C1-3(2-5)4(6)7/H2h2,1H |
| Molecular Structure | ![]() |
| Molecular Formula | C4H5Cl3 |
| Molecular Weight | 159.44 |
| CAS Registry Number | 31702-33-7 |
| SMILES | C(C(=C(Cl)Cl)C)Cl |
| InChI | 1S/C4H5Cl3/c1-3(2-5)4(6)7/h2H2,1H3 |
| InChIKey | GVFGURPOQVIHNM-UHFFFAOYSA-N |
| Density | 1.308g/cm3 (Cal.) |
|---|---|
| Boiling point | 155.999°C at 760 mmHg (Cal.) |
| Flash point | 86.793°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1,1,3-Trichloro-2-Methylprop-1-Ene |