| Name | 5-Amino-5H-Dibenzo(a,d)Cycloheptene |
|---|---|
| Synonyms | 5H-Dibenzo(A,D)Cycloheptene, 5-Amino-; Brn 2722512 |
| Molecular Structure | ![]() |
| Molecular Formula | C15H13N |
| Molecular Weight | 207.27 |
| CAS Registry Number | 31721-90-1 |
| SMILES | C3=C2C(N)C1=CC=CC=C1C=CC2=CC=C3 |
| InChI | 1S/C15H13N/c16-15-13-7-3-1-5-11(13)9-10-12-6-2-4-8-14(12)15/h1-10,15H,16H2 |
| InChIKey | HKLYXHWNPAGMMW-UHFFFAOYSA-N |
| Density | 1.122g/cm3 (Cal.) |
|---|---|
| Boiling point | 369.246°C at 760 mmHg (Cal.) |
| Flash point | 191.499°C (Cal.) |
| (1) | Carsten Böhler, Daniel Stein, Nicola Donati and Hansjörg Grützmacher. Synthesis of a transient tropylidene substituted N-heterocyclic carbene (tropNHC): rearrangement and formation of its gold complex, New J. Chem., 2002, 26, 1291. |
|---|---|
| Market Analysis Reports |
| List of Reports Available for 5-Amino-5H-Dibenzo(a,d)Cycloheptene |