|
CAS#: 31743-77-8 Product: Poly(glycidyl methacrylate-co-ethylene dimethacrylate) No suppilers available for the product. |
| Name | Poly(glycidyl methacrylate-co-ethylene dimethacrylate) |
|---|---|
| Synonyms | 2-Methylprop-2-Enoic Acid 2-(2-Methyl-1-Oxoprop-2-Enoxy)Ethyl Ester; 2-Methylprop-2-Enoic Acid 2-Oxiranylmethyl Ester; 2-Methylacrylic Acid Glycidyl Ester; 2-Methylacrylic Acid 2-Methacryloyloxyethyl Ester; Gma Edma |
| Molecular Structure | ![]() |
| Molecular Formula | C17H24O7 |
| Molecular Weight | 340.37 |
| CAS Registry Number | 31743-77-8 |
| SMILES | C(OC(=O)C(=C)C)C1OC1.C(OC(=O)C(=C)C)COC(=O)C(=C)C |
| InChI | 1S/C10H14O4.C7H10O3/c1-7(2)9(11)13-5-6-14-10(12)8(3)4;1-5(2)7(8)10-4-6-3-9-6/h1,3,5-6H2,2,4H3;6H,1,3-4H2,2H3 |
| InChIKey | BHHCZVFCISJWIX-UHFFFAOYSA-N |
| Boiling point | 260.6°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 121.8°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Poly(glycidyl methacrylate-co-ethylene dimethacrylate) |