|
CAS#: 31750-91-1 Product: Sodium S-[2-({4-[(3aR,7aS)-1,3-Dioxooctahydro-2H-Isoindol-2-Yl]Butyl}Amino)Ethyl] Hydrogen Phosphorothioate No suppilers available for the product. |
| Name | Sodium S-[2-({4-[(3aR,7aS)-1,3-Dioxooctahydro-2H-Isoindol-2-Yl]Butyl}Amino)Ethyl] Hydrogen Phosphorothioate |
|---|---|
| Synonyms | sodium s- |
| Molecular Structure | ![]() |
| Molecular Formula | C14H24N2NaO5PS |
| Molecular Weight | 386.38 |
| CAS Registry Number | 31750-91-1 |
| SMILES | [Na+].[O-]P(=O)(O)SCCNCCCCN1C(=O)[C@@H]2CCCC[C@@H]2C1=O |
| InChI | 1S/C14H25N2O5PS.Na/c17-13-11-5-1-2-6-12(11)14(18)16(13)9-4-3-7-15-8-10-23-22(19,20)21;/h11-12,15H,1-10H2,(H2,19,20,21);/q;+1/p-1/t11-,12+; |
| InChIKey | AQXWHRPIXSEZDS-IWKKHLOMSA-M |
| Boiling point | 635°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 337.8°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Sodium S-[2-({4-[(3aR,7aS)-1,3-Dioxooctahydro-2H-Isoindol-2-Yl]Butyl}Amino)Ethyl] Hydrogen Phosphorothioate |