|
CAS#: 31755-08-5 Product: (1-Tert-Butylpyrrolidin-3-Yl) N-(2-Chloro-6-Methylphenyl)Carbamate No suppilers available for the product. |
| Name | (1-Tert-Butylpyrrolidin-3-Yl) N-(2-Chloro-6-Methylphenyl)Carbamate |
|---|---|
| Synonyms | (1-Tert-Butylpyrrolidin-3-Yl) N-(2-Chloro-6-Methyl-Phenyl)Carbamate; N-(2-Chloro-6-Methylphenyl)Carbamic Acid (1-Tert-Butyl-3-Pyrrolidinyl) Ester; N-(2-Chloro-6-Methyl-Phenyl)Carbamic Acid (1-Tert-Butylpyrrolidin-3-Yl) Ester |
| Molecular Structure | ![]() |
| Molecular Formula | C16H23ClN2O2 |
| Molecular Weight | 310.82 |
| CAS Registry Number | 31755-08-5 |
| SMILES | C1=CC=C(C(=C1C)NC(OC2CN(CC2)C(C)(C)C)=O)Cl |
| InChI | 1S/C16H23ClN2O2/c1-11-6-5-7-13(17)14(11)18-15(20)21-12-8-9-19(10-12)16(2,3)4/h5-7,12H,8-10H2,1-4H3,(H,18,20) |
| InChIKey | HZPVYVIKZIPUDA-UHFFFAOYSA-N |
| Density | 1.176g/cm3 (Cal.) |
|---|---|
| Boiling point | 361.474°C at 760 mmHg (Cal.) |
| Flash point | 172.414°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for (1-Tert-Butylpyrrolidin-3-Yl) N-(2-Chloro-6-Methylphenyl)Carbamate |