|
CAS#: 31895-50-8 Product: 2-Butylamino-4,6-Dimethyl-[1,3]Thiazolo[5,4-e]Pyrimidine-5,7-Dione No suppilers available for the product. |
| Name | 2-Butylamino-4,6-Dimethyl-[1,3]Thiazolo[5,4-e]Pyrimidine-5,7-Dione |
|---|---|
| Synonyms | 2-Butylamino-4,6-Dimethyl-Thiazolo[5,4-E]Pyrimidine-5,7-Dione; 2-Butylamino-4,6-Dimethylthiazolo[5,4-E]Pyrimidine-5,7-Dione; 2-Butylamino-4,6-Dimethyl-Thiazolo[5,4-E]Pyrimidine-5,7-Quinone |
| Molecular Structure | ![]() |
| Molecular Formula | C11H16N4O2S |
| Molecular Weight | 268.33 |
| CAS Registry Number | 31895-50-8 |
| SMILES | C(NC2=NC1=C(C(N(C(N1C)=O)C)=O)S2)CCC |
| InChI | 1S/C11H16N4O2S/c1-4-5-6-12-10-13-8-7(18-10)9(16)15(3)11(17)14(8)2/h4-6H2,1-3H3,(H,12,13) |
| InChIKey | JJUOFQMPYZPUOS-UHFFFAOYSA-N |
| Density | 1.322g/cm3 (Cal.) |
|---|---|
| Boiling point | 418.524°C at 760 mmHg (Cal.) |
| Flash point | 206.916°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-Butylamino-4,6-Dimethyl-[1,3]Thiazolo[5,4-e]Pyrimidine-5,7-Dione |