|
CAS#: 31991-90-9 Product: 5-Bromo-1-Cyclopentyl-3,6-Dimethylpyrimidine-2,4-Dione No suppilers available for the product. |
| Name | 5-Bromo-1-Cyclopentyl-3,6-Dimethylpyrimidine-2,4-Dione |
|---|---|
| Synonyms | 5-Bromo-1-Cyclopentyl-3,6-Dimethyl-Pyrimidine-2,4-Dione; 5-Bromo-1-Cyclopentyl-3,6-Dimethyl-Pyrimidine-2,4-Quinone; 2,4(1H,3H)-Pyrimidinedione, 5-Bromo-1-Cyclopentyl-3,6-Dimethyl- |
| Molecular Structure | ![]() |
| Molecular Formula | C11H15BrN2O2 |
| Molecular Weight | 287.16 |
| CAS Registry Number | 31991-90-9 |
| SMILES | CC1=C(C(N(C(N1C2CCCC2)=O)C)=O)Br |
| InChI | 1S/C11H15BrN2O2/c1-7-9(12)10(15)13(2)11(16)14(7)8-5-3-4-6-8/h8H,3-6H2,1-2H3 |
| InChIKey | REEUQZUMFVRILK-UHFFFAOYSA-N |
| Density | 1.531g/cm3 (Cal.) |
|---|---|
| Boiling point | 334.304°C at 760 mmHg (Cal.) |
| Flash point | 155.982°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 5-Bromo-1-Cyclopentyl-3,6-Dimethylpyrimidine-2,4-Dione |