|
CAS#: 320-90-1 Product: Propan-2-Yl 4-Amino-2-Sulfamoylbenzoate No suppilers available for the product. |
| Name | Propan-2-Yl 4-Amino-2-Sulfamoylbenzoate |
|---|---|
| Synonyms | Isopropyl 4-Amino-2-Sulfamoyl-Benzoate; 4-Amino-2-Sulfamoylbenzoic Acid Isopropyl Ester; 4-Amino-2-Sulfamoyl-Benzoic Acid Isopropyl Ester |
| Molecular Structure | ![]() |
| Molecular Formula | C10H14N2O4S |
| Molecular Weight | 258.29 |
| CAS Registry Number | 320-90-1 |
| SMILES | C1=C(C(=CC(=C1)N)[S](N)(=O)=O)C(OC(C)C)=O |
| InChI | 1S/C10H14N2O4S/c1-6(2)16-10(13)8-4-3-7(11)5-9(8)17(12,14)15/h3-6H,11H2,1-2H3,(H2,12,14,15) |
| InChIKey | RMKBZZLNLVFLRF-UHFFFAOYSA-N |
| Density | 1.346g/cm3 (Cal.) |
|---|---|
| Boiling point | 492.646°C at 760 mmHg (Cal.) |
| Flash point | 251.743°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Propan-2-Yl 4-Amino-2-Sulfamoylbenzoate |