|
CAS#: 32150-51-9 Product: 5-Dimethylamino-1,6-Dimethyl-3-(Phenylmethyl)Pyrimidine-2,4-Dione No suppilers available for the product. |
| Name | 5-Dimethylamino-1,6-Dimethyl-3-(Phenylmethyl)Pyrimidine-2,4-Dione |
|---|---|
| Synonyms | 3-(Benzyl)-5-Dimethylamino-1,6-Dimethyl-Pyrimidine-2,4-Quinone; 2,4(1H,3H)-Pyrimidinedione, 3-Benzyl-1,6-Dimethyl-5-Dimethylamino-; 3-Benzyl-1,6-Dimethyl-5-Dimethylaminouracil |
| Molecular Structure | ![]() |
| Molecular Formula | C15H19N3O2 |
| Molecular Weight | 273.33 |
| CAS Registry Number | 32150-51-9 |
| SMILES | C1=CC=CC=C1CN2C(N(C(=C(N(C)C)C2=O)C)C)=O |
| InChI | 1S/C15H19N3O2/c1-11-13(16(2)3)14(19)18(15(20)17(11)4)10-12-8-6-5-7-9-12/h5-9H,10H2,1-4H3 |
| InChIKey | QNVOFASLYHPBMU-UHFFFAOYSA-N |
| Density | 1.212g/cm3 (Cal.) |
|---|---|
| Boiling point | 389.434°C at 760 mmHg (Cal.) |
| Flash point | 161.217°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 5-Dimethylamino-1,6-Dimethyl-3-(Phenylmethyl)Pyrimidine-2,4-Dione |