|
CAS#: 32186-94-0 Product: 2-Chloro-N,N,9-Trimethylpurin-6-Amine No suppilers available for the product. |
| Name | 2-Chloro-N,N,9-Trimethylpurin-6-Amine |
|---|---|
| Synonyms | 2-Chloro-N,N,9-Trimethyl-Purin-6-Amine; 2-Chloro-N,N,9-Trimethyl-6-Purinamine; (2-Chloro-9-Methyl-Purin-6-Yl)-Dimethyl-Amine |
| Molecular Structure | ![]() |
| Molecular Formula | C8H10ClN5 |
| Molecular Weight | 211.65 |
| CAS Registry Number | 32186-94-0 |
| SMILES | C1=NC2=C([N]1C)N=C(N=C2N(C)C)Cl |
| InChI | 1S/C8H10ClN5/c1-13(2)6-5-7(12-8(9)11-6)14(3)4-10-5/h4H,1-3H3 |
| InChIKey | ZBRXWGUFGVKAQR-UHFFFAOYSA-N |
| Density | 1.442g/cm3 (Cal.) |
|---|---|
| Boiling point | 330.639°C at 760 mmHg (Cal.) |
| Flash point | 153.765°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-Chloro-N,N,9-Trimethylpurin-6-Amine |