Online Database of Chemicals from Around the World
|
CAS#: 32292-78-7 Product: (2-Formyl-3,5-Dihydroxyphenyl) Benzoate No suppilers available for the product. |
| Name | (2-Formyl-3,5-Dihydroxyphenyl) Benzoate |
|---|---|
| Synonyms | (2-Formyl-3,5-Dihydroxy-Phenyl) Benzoate; Benzoic Acid (2-Formyl-3,5-Dihydroxyphenyl) Ester; Benzoic Acid (2-Formyl-3,5-Dihydroxy-Phenyl) Ester |
| Molecular Structure |  |
| Molecular Formula | C14H10O5 |
| Molecular Weight | 258.23 |
| CAS Registry Number | 32292-78-7 |
| EINECS | 250-981-6 |
| SMILES | C1=C(O)C=C(O)C(=C1OC(=O)C2=CC=CC=C2)C=O |
| InChI | 1S/C14H10O5/c15-8-11-12(17)6-10(16)7-13(11)19-14(18)9-4-2-1-3-5-9/h1-8,16-17H |
| InChIKey | NQGFNZGQTUVDDL-UHFFFAOYSA-N |
| Density | 1.424g/cm3 (Cal.) |
|---|---|
| Boiling point | 516.902°C at 760 mmHg (Cal.) |
| Flash point | 202.177°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for (2-Formyl-3,5-Dihydroxyphenyl) Benzoate |