|
CAS#: 32348-91-7 Product: Diazanium (4-Nitrophenyl) Phosphate No suppilers available for the product. |
| Name | Diazanium (4-Nitrophenyl) Phosphate |
|---|---|
| Synonyms | Diammonium (4-Nitrophenyl) Phosphate; Diammonium 4-Nitrophenyl Phosphate |
| Molecular Structure | ![]() |
| Molecular Formula | C6H12N3O6P |
| Molecular Weight | 253.15 |
| CAS Registry Number | 32348-91-7 |
| EINECS | 251-003-0 |
| SMILES | [N](=O)(=O)C1=CC=C(O[P]([O-])([O-])=O)C=C1.[NH4+].[NH4+] |
| InChI | 1S/C6H6NO6P.2H3N/c8-7(9)5-1-3-6(4-2-5)13-14(10,11)12;;/h1-4H,(H2,10,11,12);2*1H3 |
| InChIKey | HMBDBPRVHYUSKG-UHFFFAOYSA-N |
| Boiling point | 457.8°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 230.7°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Diazanium (4-Nitrophenyl) Phosphate |